Q. No.
1. para-Bromobenzene
2. 1,4-Dibromobenzene
3. Both (1) and (2)
4. meta-Bromobenzene
| 1. | Vinylic halide | 2. | Benzylic halide |
| 3. | Aryl halide | 4. | Allylic halide |
(CH3)2CHCH(Cl)CH3 can be classified as:
1. Secondary benzyl halide
2. Secondary alkyl halide
3. Primary alkyl halide
4. Secondary allyl halide
The position of Br in the compound in CH3CH=CHC(Br)(CH3)2 can be classified as ..........
1. Allyl
2. Aryl
3. Vinyl
4. Secondary
Which of the following are secondary bromides?
(i) (CH3)2CHBr
(ii) (CH3)3CCH2Br
(iii) CH3CH(Br)CH2CH3
(iv) (CH3)2CBrCH2CH3
Choose the correct option
1. (i, ii)
2. (ii, iii)
3. (iii, iv)
4. (i, iii)
(CH3)3CCH2CH(Br)C6H5 is:
1. Secondary benzyl halide
2. Secondary alkyl halide
3. Primary alkyl halide
4. Secondary allyl halide
CH3CH2CH(CH3)CH(C2H5)Cl is:
1. Secondary benzyl halide
2. Secondary alkyl halide
3. Primary alkyl halide
4. Secondary allyl halide
CH3CH2C(CH3)2CH2I is:
1. Secondary benzyl halide
2. Secondary alkyl halide
3. Primary alkyl halide
4. Secondary allyl halide
Match the structures given in Column I with the names in Column II.
| Column I | Column II | ||
| A. |  |
1. | 4-Bromopent-2-ene |
| B. |  |
2. | 4-Bromo-3-methylpent-2-ene |
| C. |  |
3. | 1-Bromobut-2-ene |
| D. |  |
4. | 1-Bromo-2-methylpent-2-ene |
Codes:
| A | B | C | D | |
| 1. | 2 | 3 | 4 | 1 |
| 2. | 1 | 2 | 3 | 4 |
| 3. | 1 | 4 | 3 | 2 |
| 4. | 4 | 1 | 3 | 2 |
Which of the following compounds can be classified as aryl halides?
(i) p-ClC6H4CH2CH(CH3)2
(ii) p-CH3CHCl(C6H4)CH2CH3
(iii) o-BrH2C-C6H4CH(CH3)CH2CH3
(iv) C6H5-Cl
Choose the correct option
1. (i, ii)
2. (ii, iii)
3. (iii, iv)
4. (i, iv)
© 2024 GoodEd Technologies Pvt. Ltd.