Q. No.Which of the following meta-directing substituents is the most deactivating in aromatic substitution?
1.
–SO3H
2.
–COOH
3.
–NO2
4.
–C≡N
Among the following compounds the one that is most reactive towards electrophilic nitration is:
1. Benzoic acid
2. Nitrobenzene
3. Toluene
4. Benzene
Among cyclohexanol (I), acetic acid (II), 2, 4, 6-trinitrophenol (III) and phenol (IV) the correct order of decreasing acidic character will be:
| 1. | III>II>IV>I | 2. | II>III>I>IV |
| 3. | II>III>IV>I | 4. | III>IV>II>I |
Which one is most reactive towards SN1 reaction?
1. C6H5CH(C6H5)BrC6H5CH(C6H5)Br
2. C6H5CH(CH3)BrC6H5CH(CH3)Br
3. C6H5C(CH3)(C6H5)BrC6H5C(CH3)(C6H5)Br
4. C6H5CH2BrC6H5CH2Br
| 1. |  |
2. |  |
| 3. |  |
4. |  |
Which of the following is the most correct electron displacement for a nucleophilic reaction to take place?
| 1. |  |
| 2. |  |
| 3. |  |
| 4. |  |
Following is the list of some aromatic compounds. Select the correct sequence of decreasing order of reactivity for electrophilic aromatic substitution reaction using the answer codes given below:
a. C6H5 - OHC6H5 − OH
b. C6H5 - CH3C6H5 − CH3
c. C6H5 - NO2C6H5 − NO2
d. C6H5 - CHOC6H5 − CHO
Answer codes :
1. a d b c
2. c d b a
3. a b d c
4. a b c d
Arrange the decreasing order of reactivity of these compounds for nucleophilic substitution reaction.
a. CH3-CH2-O-O||S||O-CF3CH3−CH2−O−O||S||O−CF3
b. CH3-CH2-O-TsClCH3−CH2−O−TsCl
c. CH3-CH2-ClCH3−CH2−Cl
d. CH3-CH2-BrCH3−CH2−Br
Select the correct answer from the codes given below:
Codes:
1. c, d, a, b
2. c, d, b, a
3. a, b, c, d
4. a, b, d, c
Arrange decreasing order of reactivity of given compounds with NBS/ CCl4CCl4/ hv:
a. C6H5-CH3C6H5−CH3
b. C6H5-CH2-CH2-CH3C6H5−CH2−CH2−CH3
c. C6H5-CH2-CH=CH2C6H5−CH2−CH=CH2
d. C6H5-C|CH3H-CH=CH2C6H5−C|CH3H−CH=CH2
Select the correct answer from the codes given below:
Codes :
1. d c a b
2. d c b a
3. a b c d
4. a c b d
© 2025 GoodEd Technologies Pvt. Ltd.